Mathematics · Textbook solutions

Trigonometry - II

Every solved example, exercise, and miscellaneous question — in the order the textbook teaches them. · 166 questions

3.1 Compound Angles

8 q

Solved Examples

Worked · 8
  1. 3.1 SolvedEx.1
    Find the value of cos15\cos 15^\circ.
  2. 3.1 SolvedEx.2
    Find the value of tan13π12\tan \frac{13\pi}{12}.
  3. 3.1 SolvedEx.3
    Show that sin(x+y)sin(xy)=tanx+tanytanxtany\frac{\sin(x+y)}{\sin(x-y)} = \frac{\tan x + \tan y}{\tan x - \tan y}.
  4. 3.1 SolvedEx.4
    Show that : tan3xtan2xtanx=tan3xtan2xtanx\tan 3x \, \tan 2x \, \tan x = \tan 3x - \tan 2x - \tan x
  5. 3.1 SolvedEx.5
    Show that cos(π4+x)+cos(π4x)=2cosx\cos\left(\frac{\pi}{4} + x\right) + \cos\left(\frac{\pi}{4} - x\right) = \sqrt{2}\,\cos x.
  6. 3.1 SolvedEx.6
    If tanAtanB=x\tan A - \tan B = x and cotBcotA=y\cot B - \cot A = y then show that cot(AB)=1x+1y\cot(A-B) = \frac{1}{x} + \frac{1}{y}.
  7. 3.1 SolvedEx.7
    If tanα=1x(x2+x+1)\tan\alpha = \frac{1}{\sqrt{x(x^2 + x + 1)}}, tanβ=xx2+x+1\tan\beta = \frac{\sqrt{x}}{\sqrt{x^2 + x + 1}} and tanγ=x3+x2+x1\tan\gamma = \sqrt{x^{-3} + x^{-2} + x^{-1}}, then show that α+β=γ\alpha + \beta = \gamma.
  8. 3.1 SolvedEx.8
    If sinA+sinB=x\sin A + \sin B = x and cosA+cosB=y\cos A + \cos B = y then show that sin(A+B)=2xyx2+y2\sin(A+B) = \frac{2xy}{x^2 + y^2}.

Exercise 3.1

22 q
  1. Find the values of
    Ex 3.1 Q1(i)
    sin15\sin 15^\circ
  2. Ex 3.1 Q1(ii)
    cos75\cos 75^\circ
  3. Ex 3.1 Q1(iii)
    tan105\tan 105^\circ
  4. Ex 3.1 Q1(iv)
    cot225\cot 225^\circ
  5. Prove the following.
    Ex 3.1 Q2(i)
    cos(π2x)cos(π2y)sin(π2x)sin(π2y)=cos(x+y)\cos\left(\frac{\pi}{2} - x\right)\cos\left(\frac{\pi}{2} - y\right) - \sin\left(\frac{\pi}{2} - x\right)\sin\left(\frac{\pi}{2} - y\right) = -\cos(x+y)
  6. Ex 3.1 Q2(ii)
    tan(π4+θ)=1tanθ1+tanθ\tan\left(\frac{\pi}{4} + \theta\right) = \frac{1 - \tan\theta}{1 + \tan\theta}
  7. Ex 3.1 Q2(iii)
    (1+tanx1tanx)2=tan(π4+x)tan(π4x)\left(\frac{1 + \tan x}{1 - \tan x}\right)^{2} = \frac{\tan\left(\frac{\pi}{4} + x\right)}{\tan\left(\frac{\pi}{4} - x\right)}
  8. Ex 3.1 Q2(iv)
    sin[(n+1)A]sin[(n+2)A]+cos[(n+1)A]cos[(n+2)A]=cosA\sin[(n+1)A]\cdot\sin[(n+2)A] + \cos[(n+1)A]\cdot\cos[(n+2)A] = \cos A
  9. Ex 3.1 Q2(v)
    2cos(π4A)=cosA+sinA\sqrt{2}\,\cos\left(\frac{\pi}{4} - A\right) = \cos A + \sin A
  10. Ex 3.1 Q2(vi)
    cos(xy)cos(x+y)=cotxcoty+1cotxcoty1\frac{\cos(x - y)}{\cos(x + y)} = \frac{\cot x \cot y + 1}{\cot x \cot y - 1}
  11. Ex 3.1 Q2(vii)
    cos(x+y)cos(xy)=cos2ysin2x\cos(x+y)\cdot\cos(x-y) = \cos^{2}y - \sin^{2}x
  12. Ex 3.1 Q2(viii)
    tan5Atan3Atan5A+tan3A=sin2Asin8A\frac{\tan 5A - \tan 3A}{\tan 5A + \tan 3A} = \frac{\sin 2A}{\sin 8A}
  13. Ex 3.1 Q2(ix)
    tan8θtan5θtan3θ=tan8θtan5θtan3θ\tan 8\theta - \tan 5\theta - \tan 3\theta = \tan 8\theta \tan 5\theta \tan 3\theta
  14. Ex 3.1 Q2(x)
    tan50=tan40+2tan10\tan 50^\circ = \tan 40^\circ + 2\tan 10^\circ
  15. Ex 3.1 Q2(xi)
    cos27+sin27cos27sin27=tan72\frac{\cos 27^\circ + \sin 27^\circ}{\cos 27^\circ - \sin 27^\circ} = \tan 72^\circ
  16. Ex 3.1 Q2(xii)
    tan10+tan35+tan10tan35=1\tan 10^\circ + \tan 35^\circ + \tan 10^\circ \cdot \tan 35^\circ = 1
  17. Ex 3.1 Q2(xiii)
    cotAcot4A+1cotAcot4A1=cos3Acos5A\frac{\cot A \cot 4A + 1}{\cot A \cot 4A - 1} = \frac{\cos 3A}{\cos 5A}
  18. Ex 3.1 Q2(xiv)
    cos15sin15cos15+sin15=13\frac{\cos 15^\circ - \sin 15^\circ}{\cos 15^\circ + \sin 15^\circ} = \frac{1}{\sqrt{3}}
  19. If sinA=513\sin A = \frac{-5}{13}, π<A<3π2\pi < A < \frac{3\pi}{2} and cosB=35\cos B = \frac{3}{5}, 3π2<B<2π\frac{3\pi}{2} < B < 2\pi then find
    Ex 3.1 Q3(i)
    sin(A+B)\sin(A+B)
  20. Ex 3.1 Q3(ii)
    cos(AB)\cos(A-B)
  21. Ex 3.1 Q3(iii)
    tan(A+B)\tan(A+B)
  22. Ex 3.1 Q4
    If tanA=56\tan A = \frac{5}{6}, tanB=111\tan B = \frac{1}{11}, prove that A+B=π4A + B = \frac{\pi}{4}.

3.2 Allied Angles

11 q

Solved Examples

Worked · 11
  1. Find the values of
    3.2 SolvedEx.1(i)
    (sin495)(\sin 495^\circ)
  2. 3.2 SolvedEx.1(ii)
    cos930\cos 930^\circ
  3. 3.2 SolvedEx.1(iii)
    tan840\tan 840^\circ
  4. Show that :
    3.2 SolvedEx.2(i)
    cos24+cos55+cos125+cos204+cos300=12\cos 24^\circ + \cos 55^\circ + \cos 125^\circ + \cos 204^\circ + \cos 300^\circ = \frac{1}{2}
  5. 3.2 SolvedEx.2(ii)
    sec840cot(945)+sin600tan(690)=32\sec 840^\circ \cdot \cot(-945^\circ) + \sin 600^\circ \cdot \tan(-690^\circ) = \frac{3}{2}
  6. 3.2 SolvedEx.2(iii)
    cosec(90θ)sin(180θ)cot(360θ)sec(180+θ)tan(90+θ)sin(θ)=1\frac{\operatorname{cosec}(90^\circ - \theta) \cdot \sin(180^\circ - \theta)\cot(360^\circ - \theta)}{\sec(180^\circ + \theta)\tan(90^\circ + \theta)\sin(-\theta)} = 1
  7. 3.2 SolvedEx.2(iv)
    cot(π2+θ)sin(θ)cot(πθ)cos(2πθ)sin(π+θ)tan(2πθ)=cosecθ\frac{\cot\left(\frac{\pi}{2} + \theta\right)\sin(-\theta)\cot(\pi - \theta)}{\cos(2\pi - \theta)\sin(\pi + \theta)\tan(2\pi - \theta)} = -\operatorname{cosec}\theta
  8. Prove the following :
    3.2 SolvedEx.3(i)
    sinπ15+sin4π15sin14π15sin11π15=0\sin\frac{\pi}{15} + \sin\frac{4\pi}{15} - \sin\frac{14\pi}{15} - \sin\frac{11\pi}{15} = 0
  9. 3.2 SolvedEx.3(ii)
    sin2(π4x)+sin2(π4+x)=1\sin^{2}\left(\frac{\pi}{4} - x\right) + \sin^{2}\left(\frac{\pi}{4} + x\right) = 1
  10. 3.2 SolvedEx.3(iii)
    sin2π8+sin23π8+sin25π8+sin27π8=2\sin^{2}\frac{\pi}{8} + \sin^{2}\frac{3\pi}{8} + \sin^{2}\frac{5\pi}{8} + \sin^{2}\frac{7\pi}{8} = 2
  11. 3.2 SolvedEx.3(iv)
    cos2(π10)+cos2(2π5)+cos2(3π5)+cos2(9π10)=2\cos^{2}\left(\frac{\pi}{10}\right) + \cos^{2}\left(\frac{2\pi}{5}\right) + \cos^{2}\left(\frac{3\pi}{5}\right) + \cos^{2}\left(\frac{9\pi}{10}\right) = 2

Exercise 3.2

16 q
  1. Find the value of :
    Ex 3.2 Q1(i)
    sin690\sin 690^\circ
  2. Ex 3.2 Q1(ii)
    sin(495)\sin (495^\circ)
  3. Ex 3.2 Q1(iii)
    cos315\cos 315^\circ
  4. Ex 3.2 Q1(iv)
    cos(600)\cos (600^\circ)
  5. Ex 3.2 Q1(v)
    tan225\tan 225^\circ
  6. Ex 3.2 Q1(vi)
    tan(690)\tan (-690^\circ)
  7. Ex 3.2 Q1(vii)
    sec240\sec 240^\circ
  8. Ex 3.2 Q1(viii)
    sec(855)\sec (-855^\circ)
  9. Ex 3.2 Q1(ix)
    cosec780\operatorname{cosec} 780^\circ
  10. Ex 3.2 Q1(x)
    cot(1110)\cot (-1110^\circ)
  11. Prove the following:
    Ex 3.2 Q2(i)
    cos(π+x)cos(x)sin(πx)cos(π2+x)=cot2x\dfrac{\cos(\pi + x)\cos(-x)}{\sin(\pi - x)\cos\left(\dfrac{\pi}{2} + x\right)} = \cot^2 x
  12. Ex 3.2 Q2(ii)
    cos(3π2+x)cos(2π+x)[cot(3π2x)+cot(2π+x)]=1\cos\left(\dfrac{3\pi}{2} + x\right)\cos(2\pi + x)\left[\cot\left(\dfrac{3\pi}{2} - x\right) + \cot(2\pi + x)\right] = 1
  13. Ex 3.2 Q2(iii)
    sec840cot(945)+sin600tan(690)=32\sec 840^\circ \cdot \cot(-945^\circ) + \sin 600^\circ \tan(-690^\circ) = \dfrac{3}{2}
  14. Ex 3.2 Q2(iv)
    cosec(90x)sin(180x)cot(360x)sec(180+x)tan(90+x)sin(x)=1\dfrac{\operatorname{cosec}(90^\circ - x)\sin(180^\circ - x)\cot(360^\circ - x)}{\sec(180^\circ + x)\tan(90^\circ + x)\sin(-x)} = 1
  15. Ex 3.2 Q2(v)
    sin3(π+x)sec2(πx)tan(2πx)cos2(π2+x)sin(πx)cosec2x=tan3x\dfrac{\sin^3(\pi + x)\sec^2(\pi - x)\tan(2\pi - x)}{\cos^2\left(\dfrac{\pi}{2} + x\right)\sin(\pi - x)\operatorname{cosec}^2 - x} = \tan^3 x
  16. Ex 3.2 Q2(vi)
    cosθ+sin(270+θ)sin(270θ)+cos(180+θ)=0\cos\theta + \sin(270^\circ + \theta) - \sin(270^\circ - \theta) + \cos(180^\circ + \theta) = 0

3.3 Multiple Angles — Double and Triple

12 q

Solved Examples

Worked · 12
  1. 3.3.2 SolvedEx.1
    Prove that 1+tanθtanθ2=secθ1 + \tan\theta\,\tan\dfrac{\theta}{2} = \sec\theta.
  2. 3.3.2 SolvedEx.2
    Prove that tan20tan40tan60tan80=3\tan 20^\circ\,\tan 40^\circ\,\tan 60^\circ\,\tan 80^\circ = 3.
  3. 3.3.2 SolvedEx.3
    Prove that 2cosec2x+cosecx=secxcot(x2)2\operatorname{cosec} 2x + \operatorname{cosec} x = \sec x\cdot\cot\left(\dfrac{x}{2}\right).
  4. 3.3.2 SolvedEx.4
    Prove that cos3θcos3θcosθ+sin3θ+sin3θsinθ=3\dfrac{\cos^3\theta - \cos 3\theta}{\cos\theta} + \dfrac{\sin^3\theta + \sin 3\theta}{\sin\theta} = 3.
  5. 3.3.2 SolvedEx.5
    Prove that tan5A+tan3Atan5Atan3A=4cos2Acos4A\dfrac{\tan 5A + \tan 3A}{\tan 5A - \tan 3A} = 4\cos^2 A\cdot\cos 4A.
  6. 3.3.2 SolvedEx.6
    Show that (cosθ+isinθ)3=cos3θ+isin3θ(\cos\theta + i\sin\theta)^3 = \cos 3\theta + i\sin 3\theta, where i2=1i^2 = -1.
  7. 3.3.2 SolvedEx.7
    Show that 4sinθcos3θ4cosθsin3θ=sin4θ4\sin\theta\cos^3\theta - 4\cos\theta\sin^3\theta = \sin 4\theta.
  8. 3.3.2 SolvedEx.8
    Show that 1+sin2A1sin2A=tan(π4+A)\sqrt{\dfrac{1 + \sin 2A}{1 - \sin 2A}} = \tan\left(\dfrac{\pi}{4} + A\right).
  9. 3.3.2 SolvedEx.9
    Find sinx2\sin\dfrac{x}{2}, cosx2\cos\dfrac{x}{2}, tanx2\tan\dfrac{x}{2} if tanx=43\tan x = \dfrac{4}{3}, xx lies in II quadrant.
  10. 3.3.2 SolvedEx.10
    Find the value of tanπ8\tan\dfrac{\pi}{8}.
  11. 3.3.2 SolvedEx.11
    Prove that cos2x+cos2(x+π3)+cos2(xπ3)=32\cos^2 x + \cos^2\left(x + \dfrac{\pi}{3}\right) + \cos^2\left(x - \dfrac{\pi}{3}\right) = \dfrac{3}{2}.
  12. 3.3.2 SolvedEx.12
    Find sinπ10\sin\dfrac{\pi}{10}.

Exercise 3.3

22 q
  1. Find values of :
    Ex 3.3 Q1(i)
    sinπ8\sin\frac{\pi}{8}
  2. Ex 3.3 Q1(ii)
    cosπ8\cos\frac{\pi}{8}
  3. Ex 3.3 Q2
    Find sin2x\sin 2x, cos2x\cos 2x, tan2x\tan 2x if secx=135\sec x = \frac{-13}{5}, π2<x<π\frac{\pi}{2} < x < \pi.
  4. Prove the following:
    Ex 3.3 Q3(i)
    1cos2θ1+cos2θ=tan2θ\frac{1-\cos 2\theta}{1+\cos 2\theta} = \tan^2\theta
  5. Ex 3.3 Q3(ii)
    (sin3x+sinx)sinx+(cos3xcosx)cosx=0(\sin 3x + \sin x)\sin x + (\cos 3x - \cos x)\cos x = 0
  6. Ex 3.3 Q3(iii)
    (cosx+cosy)2+(sinxsiny)2=4cos2(x+y)2(\cos x + \cos y)^2 + (\sin x - \sin y)^2 = 4\cos^2\frac{(x+y)}{2}
  7. Ex 3.3 Q3(iv)
    (cosxcosy)2+(sinxsiny)2=4sin2(xy)2(\cos x - \cos y)^2 + (\sin x - \sin y)^2 = 4\sin^2\frac{(x-y)}{2}
  8. Ex 3.3 Q3(v)
    tanx+cotx=2cosec2x\tan x + \cot x = 2\operatorname{cosec} 2x
  9. Ex 3.3 Q3(vi)
    cosx+sinxcosxsinxcosxsinxcosx+sinx=2tan2x\frac{\cos x + \sin x}{\cos x - \sin x} - \frac{\cos x - \sin x}{\cos x + \sin x} = 2\tan 2x
  10. Ex 3.3 Q3(vii)
    2+2+2+2cos8x=2cosx\sqrt{2+\sqrt{2+\sqrt{2+2\cos 8x}}} = 2\cos x
  11. Ex 3.3 Q3(viii)
    16sinθcosθcos2θcos4θcos8θ=sin16θ16\sin\theta\cos\theta\cos 2\theta\cos 4\theta\cos 8\theta = \sin 16\theta
  12. Ex 3.3 Q3(ix)
    sin3xcosx+cos3xsinx=2cot2x\frac{\sin 3x}{\cos x} + \frac{\cos 3x}{\sin x} = 2\cot 2x
  13. Ex 3.3 Q3(x)
    cosx1+sinx=cot(x2)1cot(x2)+1\frac{\cos x}{1+\sin x} = \frac{\cot\left(\frac{x}{2}\right)-1}{\cot\left(\frac{x}{2}\right)+1}
  14. Ex 3.3 Q3(xi)
    tan(θ2)+cot(θ2)cot(θ2)tan(θ2)=secθ\frac{\tan\left(\frac{\theta}{2}\right)+\cot\left(\frac{\theta}{2}\right)}{\cot\left(\frac{\theta}{2}\right)-\tan\left(\frac{\theta}{2}\right)} = \sec\theta
  15. Ex 3.3 Q3(xii)
    1tan3AtanA1cot3AcotA=cot2A\frac{1}{\tan 3A - \tan A} - \frac{1}{\cot 3A - \cot A} = \cot 2A
  16. Ex 3.3 Q3(xiii)
    cos7cos14cos28cos56=sin6816cos83\cos 7^\circ\cos 14^\circ\cos 28^\circ\cos 56^\circ = \frac{\sin 68^\circ}{16\cos 83^\circ}
  17. Ex 3.3 Q3(xiv)
    sin2(160)sin270+sin(180θ)sinθ=sec220\frac{\sin^2(-160^\circ)}{\sin^2 70^\circ} + \frac{\sin(180^\circ-\theta)}{\sin\theta} = \sec^2 20^\circ
  18. Ex 3.3 Q3(xv)
    2cos4x+12cosx+1=(2cosx1)(2cos2x1)\frac{2\cos 4x + 1}{2\cos x + 1} = (2\cos x - 1)(2\cos 2x - 1)
  19. Ex 3.3 Q3(xvi)
    cos2x+cos2(x+120)+cos2(x120)=32\cos^2 x + \cos^2(x+120^\circ) + \cos^2(x-120^\circ) = \frac{3}{2}
  20. Ex 3.3 Q3(xvii)
    2cosec2x+cosecx=secxcot(x2)2\operatorname{cosec} 2x + \operatorname{cosec} x = \sec x\cot\left(\frac{x}{2}\right)
  21. Ex 3.3 Q3(xviii)
    4cosxcos(x+π3)+cos2(ππ3)=cos3x4\cos x\cos\left(x+\frac{\pi}{3}\right) + \cos^2\left(\pi-\frac{\pi}{3}\right) = \cos 3x
  22. Ex 3.3 Q3(xix)
    sinxtan(x2)+2cosx=21+tan2(x2)\sin x\tan\left(\frac{x}{2}\right) + 2\cos x = \frac{2}{1+\tan^2\left(\frac{x}{2}\right)}

3.4 Factorization and Defactorization Formulae

10 q

Solved Examples

Worked · 10
  1. Prove the following :
    3.4.2 SolvedEx.1(i)
    sin40cos70=3cos80\sin 40^\circ - \cos 70^\circ = \sqrt{3}\cos 80^\circ
  2. 3.4.2 SolvedEx.1(ii)
    cos40+cos50+cos70+cos80=cos20+cos10\cos 40^\circ + \cos 50^\circ + \cos 70^\circ + \cos 80^\circ = \cos 20^\circ + \cos 10^\circ
  3. Express the following as sum or difference of two trigonometric function:
    3.4.2 SolvedEx.2(i)
    2sin4θcos2θ2\sin 4\theta\cos 2\theta
  4. 3.4.2 SolvedEx.2(ii)
    4sin(A+B2)sin(AB2)4\sin\left(\frac{A+B}{2}\right)\sin\left(\frac{A-B}{2}\right)
  5. Show that
    3.4.2 SolvedEx.3(i)
    sin8x+sin2xcos2xcos8x=cos3x\frac{\sin 8x + \sin 2x}{\cos 2x - \cos 8x} = \cos 3x
  6. 3.4.2 SolvedEx.3(ii)
    sin2α+sin2βsin2αsin2β=tan(α+β)tan(αβ)\frac{\sin 2\alpha + \sin 2\beta}{\sin 2\alpha - \sin 2\beta} = \frac{\tan(\alpha+\beta)}{\tan(\alpha-\beta)}
  7. Prove that following.
    3.4.2 SolvedEx.4(i)
    cos(7x5y)+cos(7y5x)sin(7x5y)+sin(7y5x)=cot(x+y)\frac{\cos(7x-5y)+\cos(7y-5x)}{\sin(7x-5y)+\sin(7y-5x)} = \cot(x+y)
  8. 3.4.2 SolvedEx.4(ii)
    sin6θ+sin4θsin2θ=4cosθsin2θcos3θ\sin 6\theta + \sin 4\theta - \sin 2\theta = 4\cos\theta\sin 2\theta\cos 3\theta
  9. 3.4.2 SolvedEx.4(iii)
    cos3xsin9xsinxcos5xcosxcos5xsin3xsin9x=tan8x\frac{\cos 3x\sin 9x - \sin x\cos 5x}{\cos x\cos 5x - \sin 3x\sin 9x} = \tan 8x
  10. 3.4.2 SolvedEx.4(iv)
    cos20cos40cos60cos80=116\cos 20^\circ\cos 40^\circ\cos 60^\circ\cos 80^\circ = \frac{1}{16}

Exercise 3.4

10 q
  1. Express the following as a sum or difference of two trigonometric function.
    Ex 3.4 Q1(i)
    2sin4xcos2x2\sin 4x\,\cos 2x
  2. Ex 3.4 Q1(ii)
    2sin2π3cosπ22\sin \dfrac{2\pi}{3}\,\cos \dfrac{\pi}{2}
  3. Ex 3.4 Q1(iii)
    2cos4θcos2θ2\cos 4\theta\,\cos 2\theta
  4. Ex 3.4 Q1(iv)
    2cos35cos752\cos 35^\circ\,\cos 75^\circ
  5. Prove the following :
    Ex 3.4 Q2(i)
    sin2x+sin2ysin2xsin2y=tan(x+y)tan(xy)\dfrac{\sin 2x + \sin 2y}{\sin 2x - \sin 2y} = \dfrac{\tan(x + y)}{\tan(x - y)}
  6. Ex 3.4 Q2(ii)
    sin6x+sin4xsin2x=4cosxsin2xcos3x\sin 6x + \sin 4x - \sin 2x = 4\cos x\,\sin 2x\,\cos 3x
  7. Ex 3.4 Q2(iii)
    sinxsin3x+sin5xsin7xcosxcos3xcos5x+cos7x=cot2x\dfrac{\sin x - \sin 3x + \sin 5x - \sin 7x}{\cos x - \cos 3x - \cos 5x + \cos 7x} = \cot 2x
  8. Ex 3.4 Q2(iv)
    sin18cos39+sin6cos15=sin24cos33\sin 18^\circ\,\cos 39^\circ + \sin 6^\circ\,\cos 15^\circ = \sin 24^\circ\,\cos 33^\circ
  9. Ex 3.4 Q2(v)
    cos20cos40cos60cos80=116\cos 20^\circ\,\cos 40^\circ\,\cos 60^\circ\,\cos 80^\circ = \dfrac{1}{16}
  10. Ex 3.4 Q2(vi)
    sin20sin40sin60sin80=316\sin 20^\circ\,\sin 40^\circ\,\sin 60^\circ\,\sin 80^\circ = \dfrac{3}{16}

3.5 Trigonometric Functions of Angles of a Triangle

6 q

Solved Examples

Worked · 6
  1. In ΔABC\Delta ABC prove that
    3.5 SolvedEx.1(i)
    sin2A+sin2Bsin2C=4cosAcosBsinC\sin 2A + \sin 2B - \sin 2C = 4\cos A\,\cos B\,\sin C
  2. 3.5 SolvedEx.1(ii)
    cosA+cosB+cosC=1+4sinA2sinB2sinC2\cos A + \cos B + \cos C = 1 + 4\sin\dfrac{A}{2}\,\sin\dfrac{B}{2}\,\sin\dfrac{C}{2}
  3. 3.5 SolvedEx.1(iii)
    sin2A+sin2Bsin2C=2sinAsinBcosC\sin^2 A + \sin^2 B - \sin^2 C = 2\sin A\,\sin B\,\cos C
  4. 3.5 SolvedEx.1(iv)
    cotAcotB+cotBcot+cotCcotA=1\cot A\,\cot B + \cot B\,\cot + \cot C\,\cot A = 1
  5. 3.5 SolvedEx.1(v)
    tanA2tanB2+tanB2tanC2+tanC2tanA2=1\tan\dfrac{A}{2}\,\tan\dfrac{B}{2} + \tan\dfrac{B}{2}\,\tan\dfrac{C}{2} + \tan\dfrac{C}{2}\,\tan\dfrac{A}{2} = 1
  6. 3.5 SolvedEx.1(vi)
    cosAcosB+cosC+1cosA+cosB+cosC1=cotA2cotC2\dfrac{\cos A - \cos B + \cos C + 1}{\cos A + \cos B + \cos C - 1} = \cot\dfrac{A}{2}\,\cot\dfrac{C}{2}

Exercise 3.5

8 q
  1. Ex 3.5 Q1
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that cos2A+cos2B+cos2C=14cosAcosBcosC\cos 2A + \cos 2B + \cos 2C = -1 - 4\cos A\cos B\cos C.
  2. Ex 3.5 Q2
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that sinA+sinB+sinC=4cosA2cosB2cosC2\sin A + \sin B + \sin C = 4\cos\dfrac{A}{2}\cos\dfrac{B}{2}\cos\dfrac{C}{2}.
  3. Ex 3.5 Q3
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that cosA+cosBcosC=4cosA2cosB2sinC21\cos A + \cos B - \cos C = 4\cos\dfrac{A}{2}\cos\dfrac{B}{2}\sin\dfrac{C}{2} - 1.
  4. Ex 3.5 Q4
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that sin2A+sin2B+sin2C=2+2cosAcosBcosC\sin^{2} A + \sin^{2} B + \sin^{2} C = 2 + 2\cos A\cos B\cos C.
  5. Ex 3.5 Q5
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that sin2A2+sin2B2sin2C2=12cosA2cosB2sinC2\sin^{2}\dfrac{A}{2} + \sin^{2}\dfrac{B}{2} - \sin^{2}\dfrac{C}{2} = 1 - 2\cos\dfrac{A}{2}\cos\dfrac{B}{2}\sin\dfrac{C}{2}.
  6. Ex 3.5 Q6
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that cotA2+cotB2+cotC2=cotA2cotB2cotC2\cot\dfrac{A}{2} + \cot\dfrac{B}{2} + \cot\dfrac{C}{2} = \cot\dfrac{A}{2}\cot\dfrac{B}{2}\cot\dfrac{C}{2}.
  7. Ex 3.5 Q7
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that tan2A+tan2B+tan2C=tan2Atan2Btan2C\tan 2A + \tan 2B + \tan 2C = \tan 2A\,\tan 2B\,\tan 2C.
  8. Ex 3.5 Q8
    In ΔABC\Delta ABC, A+B+C=πA + B + C = \pi. Show that cos2A+cos2Bcos2C=12sinAsinBcosC\cos^{2} A + \cos^{2} B - \cos^{2} C = 1 - 2\sin A\sin B\cos C.

Miscellaneous Exercise 3

41 q

(I) Select the correct option

Practice · 10
  1. Misc I Q1
    The value of sin(n+1)Asin(n+2)A+cos(n+1)Acos(n+2)A\sin (n+1)A\,\sin (n+2)A + \cos (n+1)A\,\cos (n+2)A is equal to
    1. A.
      sinA\sin A
    2. B.
      cosA\cos A
    3. C.
      cosA-\cos A
    4. D.
      sin2A\sin 2A
  2. Misc I Q2
    If tanAtanB=x\tan A - \tan B = x and cotBcotA=y\cot B - \cot A = y then cot(AB)=\cot (A - B) = \ldots
    1. A.
      1y1x\dfrac{1}{y} - \dfrac{1}{x}
    2. B.
      1x1y\dfrac{1}{x} - \dfrac{1}{y}
    3. C.
      1x+1y\dfrac{1}{x} + \dfrac{1}{y}
    4. D.
      xyxy\dfrac{xy}{x-y}
  3. Misc I Q3
    If sinθ=nsin(θ+2α)\sin\theta = n\sin (\theta + 2\alpha) then tan(θ+α)\tan (\theta + \alpha) is equal to
    1. A.
      1+n2ntanα\dfrac{1+n}{2-n}\,\tan\alpha
    2. B.
      1n1+ntanα\dfrac{1-n}{1+n}\,\tan\alpha
    3. C.
      tanα\tan\alpha
    4. D.
      1+n1ntanα\dfrac{1+n}{1-n}\,\tan\alpha
  4. Misc I Q4
    The value of cosθ1+sinθ\dfrac{\cos\theta}{1 + \sin\theta} is equal to\ldots\ldots
    1. A.
      tan(θ2π4)\tan\left(\dfrac{\theta}{2} - \dfrac{\pi}{4}\right)
    2. B.
      tan(π4θ2)\tan\left(-\dfrac{\pi}{4} - \dfrac{\theta}{2}\right)
    3. C.
      tan(π4θ2)\tan\left(\dfrac{\pi}{4} - \dfrac{\theta}{2}\right)
    4. D.
      tan(π4+θ2)\tan\left(\dfrac{\pi}{4} + \dfrac{\theta}{2}\right)
  5. Misc I Q5
    The value of cosAcos(60A)cos(60+A)\cos A\,\cos (60^\circ - A)\,\cos (60^\circ + A) is equal to\ldots\ldots
    1. A.
      12cos3A\dfrac{1}{2}\cos 3A
    2. B.
      cos3A\cos 3A
    3. C.
      14cos3A\dfrac{1}{4}\cos 3A
    4. D.
      4cos3A4\cos 3A
  6. Misc I Q6
    The value of sinπ14sin3π14sin5π14sin7π14sin9π14sin11π14sin13π14\sin\dfrac{\pi}{14}\,\sin\dfrac{3\pi}{14}\,\sin\dfrac{5\pi}{14}\,\sin\dfrac{7\pi}{14}\,\sin\dfrac{9\pi}{14}\,\sin\dfrac{11\pi}{14}\,\sin\dfrac{13\pi}{14} is .\ldots.
    1. A.
      116\dfrac{1}{16}
    2. B.
      164\dfrac{1}{64}
    3. C.
      1128\dfrac{1}{128}
    4. D.
      1256\dfrac{1}{256}
  7. Misc I Q7
    If α+β+ϰ=π\alpha + \beta + \varkappa = \pi then the value of sin2α+sin2βsin2ϰ\sin^{2}\alpha + \sin^{2}\beta - \sin^{2}\varkappa is equal to\ldots\ldots
    1. A.
      2sinα2\sin\alpha
    2. B.
      2sinαcosβsinϰ2\sin\alpha\,\cos\beta\,\sin\varkappa
    3. C.
      2sinαsinβcosϰ2\sin\alpha\,\sin\beta\,\cos\varkappa
    4. D.
      2sinαsinβsinϰ2\sin\alpha\,\sin\beta\,\sin\varkappa
  8. Misc I Q8
    Let 0<A, B<π20 < A,\ B < \dfrac{\pi}{2} satisfying the equation 3sin2A+2sin2B=13\sin^{2} A + 2\sin^{2} B = 1 and 3sin2A2sin2B=03\sin 2A - 2\sin 2B = 0 then A+2BA + 2B is equal to.\ldots.
    1. A.
      π\pi
    2. B.
      π2\dfrac{\pi}{2}
    3. C.
      π4\dfrac{\pi}{4}
    4. D.
      2π2\pi
  9. Misc I Q9
    In ΔABC\Delta ABC if cotAcotBcotC>0\cot A\,\cot B\,\cot C > 0 then the triangle is.\ldots.
    1. A.
      Acute angled
    2. B.
      right angled
    3. C.
      obtuse angled
    4. D.
      isosceles right angled
  10. Misc I Q10
    The numerical value of tan20tan80cot50\tan 20^\circ\,\tan 80^\circ\,\cot 50^\circ is equal to\ldots\ldots
    1. A.
      3\sqrt{3}
    2. B.
      13\dfrac{1}{\sqrt{3}}
    3. C.
      232\sqrt{3}
    4. D.
      123\dfrac{1}{2\sqrt{3}}

(II) Prove the following

Practice · 31
  1. Misc II Q1
    Prove that tan20tan80cot50=3\tan 20^\circ\,\tan 80^\circ\,\cot 50^\circ = \sqrt{3}.
  2. Misc II Q2
    If sinαsinβcosαcosβ+1=0\sin\alpha\,\sin\beta - \cos\alpha\,\cos\beta + 1 = 0 then prove that cotαtanβ=1\cot\alpha\,\tan\beta = -1.
  3. Misc II Q3
    Prove that cos2π15cos4π15cos8π15cos16π15=116\cos\dfrac{2\pi}{15}\,\cos\dfrac{4\pi}{15}\,\cos\dfrac{8\pi}{15}\,\cos\dfrac{16\pi}{15} = \dfrac{1}{16}.
  4. Misc II Q4
    Prove that (1+cosπ8)(1+cos3π8)(1+cos5π8)(1+cos7π8)=18\left(1 + \cos\dfrac{\pi}{8}\right)\left(1 + \cos\dfrac{3\pi}{8}\right)\left(1 + \cos\dfrac{5\pi}{8}\right)\left(1 + \cos\dfrac{7\pi}{8}\right) = \dfrac{1}{8}.
  5. Misc II Q5
    Prove that cos12+cos84+cos156+cos132=12\cos 12^\circ + \cos 84^\circ + \cos 156^\circ + \cos 132^\circ = -\dfrac{1}{2}.
  6. Misc II Q6
    Prove that cos(π4+x)+cos(π4x)=2cosx\cos\left(\dfrac{\pi}{4} + x\right) + \cos\left(\dfrac{\pi}{4} - x\right) = \sqrt{2}\,\cos x.
  7. Misc II Q7
    Prove that sin5x2sin3x+sinxcos5xcosx=tanx\dfrac{\sin 5x - 2\sin 3x + \sin x}{\cos 5x - \cos x} = \tan x.
  8. Misc II Q8
    Prove that sin26xsin24x=sin2xsin10x\sin^{2} 6x - \sin^{2} 4x = \sin 2x\,\sin 10x.
  9. Misc II Q9
    Prove that cos22xcos26x=sin4xsin8x\cos^{2} 2x - \cos^{2} 6x = \sin 4x\,\sin 8x.
  10. Misc II Q10
    Prove that cot4x(sin5x+sin3x)=cotx(sin5xsin3x)\cot 4x\,(\sin 5x + \sin 3x) = \cot x\,(\sin 5x - \sin 3x).
  11. Misc II Q11
    Prove that cos9xcos5xsin17xsin3x=sin2xcos10x\dfrac{\cos 9x - \cos 5x}{\sin 17x - \sin 3x} = -\,\dfrac{\sin 2x}{\cos 10x}.
  12. Misc II Q12
    If sin2A=λsin2B\sin 2A = \lambda\sin 2B then prove that tan(A+B)tan(AB)=λ+1λ1\dfrac{\tan (A + B)}{\tan (A - B)} = \dfrac{\lambda + 1}{\lambda - 1}.
  13. Misc II Q13
    Prove that 2cos2A+12cos2A1=tan(60+A)tan(60A)\dfrac{2\cos 2A + 1}{2\cos 2A - 1} = \tan (60^\circ + A)\,\tan (60^\circ - A).
  14. Misc II Q14
    Prove that tanA+tan(60+A)+tan(120+A)=3tan3A\tan A + \tan (60^\circ + A) + \tan (120^\circ + A) = 3\tan 3A.
  15. Misc II Q15
    Prove that 3tan61027tan410+33tan210=13\tan^{6}10^\circ - 27\tan^{4}10^\circ + 33\tan^{2}10^\circ = 1.
  16. Misc II Q16
    Prove that cosec48+cosec96+cosec192+cosec384=0\operatorname{cosec} 48^\circ + \operatorname{cosec} 96^\circ + \operatorname{cosec} 192^\circ + \operatorname{cosec} 384^\circ = 0.
  17. Misc II Q17
    Prove that 3(sinxcosx)4+6(sinx+cosx)2+4(sin6x+cos6x)=133(\sin x - \cos x)^{4} + 6(\sin x + \cos x)^{2} + 4(\sin^{6} x + \cos^{6} x) = 13.
  18. Misc II Q18
    Prove that tanA+2tan2A+4tan4A+8cot8A=cotA\tan A + 2\tan 2A + 4\tan 4A + 8\cot 8A = \cot A.
  19. Misc II Q19
    If A+B+C=3π2A + B + C = \dfrac{3\pi}{2} then prove that cos2A+cos2B+cos2C=14sinAsinBsinC\cos 2A + \cos 2B + \cos 2C = 1 - 4\sin A\,\sin B\,\sin C.
  20. Misc II Q20
    In any triangle ABCABC, sinAcosB=cosC\sin A - \cos B = \cos C then prove that B=π2\angle B = \dfrac{\pi}{2}.
  21. Misc II Q21
    Prove that tan3x1+tan2x+cot3x1+cot2x=secxcosecx2sinxcosx\dfrac{\tan^{3} x}{1 + \tan^{2} x} + \dfrac{\cot^{3} x}{1 + \cot^{2} x} = \sec x\,\operatorname{cosec} x - 2\sin x\,\cos x.
  22. Misc II Q22
    Prove that sin20sin40sin80=38\sin 20^\circ\,\sin 40^\circ\,\sin 80^\circ = \dfrac{\sqrt{3}}{8}.
  23. Misc II Q23
    Prove that sin18=514\sin 18^\circ = \dfrac{\sqrt{5} - 1}{4}.
  24. Misc II Q24
    Prove that cos36=5+14\cos 36^\circ = \dfrac{\sqrt{5} + 1}{4}.
  25. Misc II Q25
    Prove that sin36=10254\sin 36^\circ = \dfrac{\sqrt{10 - 2\sqrt{5}}}{4}.
  26. Misc II Q26
    Prove that sinπc8=1222\sin\dfrac{\pi^{c}}{8} = \dfrac{1}{2}\sqrt{2 - \sqrt{2}}.
  27. Misc II Q27
    Prove that tanπ8=21\tan\dfrac{\pi}{8} = \sqrt{2} - 1.
  28. Misc II Q28
    Prove that tan6tan42tan66tan78=1\tan 6^\circ\,\tan 42^\circ\,\tan 66^\circ\,\tan 78^\circ = 1.
  29. Misc II Q29
    Prove that sin47+sin61sin11sin25=cos7\sin 47^\circ + \sin 61^\circ - \sin 11^\circ - \sin 25^\circ = \cos 7^\circ.
  30. Misc II Q30
    Prove that 3cosec20sec20=4\sqrt{3}\,\operatorname{cosec} 20^\circ - \sec 20^\circ = 4.
  31. Misc II Q31
    In ΔABC\Delta ABC, C=2π3\angle C = \dfrac{2\pi}{3} then prove that cos2A+cos2BcosAcosB=34\cos^{2} A + \cos^{2} B - \cos A\,\cos B = \dfrac{3}{4}.